C34H45FN4O4Si — CID 142754479
tert-butyl 3-(3-fluoro-4-methoxyphenyl)-3-[5-[3-(1,8-naphthyridin-2-yl)propyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]propanoate (PubChem CID 142754479) has the molecular formula C34H45FN4O4Si and a molecular weight of 620.84 g/mol. Its IUPAC name is tert-butyl 3-(3-fluoro-4-methoxyphenyl)-3-[5-[3-(1,8-naphthyridin-2-yl)propyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]propanoate.
| Compound Name | tert-butyl 3-(3-fluoro-4-methoxyphenyl)-3-[5-[3-(1,8-naphthyridin-2-yl)propyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]propanoate |
|---|---|
| PubChem CID | 142754479 |
| Molecular Formula | C34H45FN4O4Si |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | tert-butyl 3-(3-fluoro-4-methoxyphenyl)-3-[5-[3-(1,8-naphthyridin-2-yl)propyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]propanoate |
| SMILES | COc1ccc(C(CC(=O)OC(C)(C)C)c2cc(CCCc3ccc4cccnc4n3)n(COCC[Si](C)(C)C)n2)cc1F |
| InChI | InChI=1S/C34H45FN4O4Si/c1-34(2,3)43-32(40)22-28(25-14-16-31(41-4)29(35)20-25)30-21-27(39(38-30)23-42-18-19-44(5,6)7)12-8-11-26-15-13-24-10-9-17-36-33(24)37-26/h9-10,13-17,20-21,28H,8,11-12,18-19,22-23H2,1-7H3 |
| InChIKey | JAHJZKMCDCYWHV-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|