C28H47N5O4S2 — CID 142349902
S-[(E)-4-(14-ethyl-1,12-dimethyl-2,5,9-trioxo-16-thia-3,6,10,13,18-pentazabicyclo[13.2.1]octadec-15(18)-en-7-yl)but-3-enyl] octanethioate (PubChem CID 142349902) has the molecular formula C28H47N5O4S2 and a molecular weight of 581.85 g/mol. Its IUPAC name is S-[(E)-4-(14-ethyl-1,12-dimethyl-2,5,9-trioxo-16-thia-3,6,10,13,18-pentazabicyclo[13.2.1]octadec-15(18)-en-7-yl)but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-(14-ethyl-1,12-dimethyl-2,5,9-trioxo-16-thia-3,6,10,13,18-pentazabicyclo[13.2.1]octadec-15(18)-en-7-yl)but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 142349902 |
| Molecular Formula | C28H47N5O4S2 |
| Molecular Weight | 581.85 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | S-[(E)-4-(14-ethyl-1,12-dimethyl-2,5,9-trioxo-16-thia-3,6,10,13,18-pentazabicyclo[13.2.1]octadec-15(18)-en-7-yl)but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/C1CC(=O)NCC(C)NC(CC)C2=NC(C)(CS2)C(=O)NCC(=O)N1 |
| InChI | InChI=1S/C28H47N5O4S2/c1-5-7-8-9-10-14-25(36)38-15-12-11-13-21-16-23(34)29-17-20(3)31-22(6-2)26-33-28(4,19-39-26)27(37)30-18-24(35)32-21/h11,13,20-22,31H,5-10,12,14-19H2,1-4H3,(H,29,34)(H,30,37)(H,32,35)/b13-11+ |
| InChIKey | SXIPCSOERJZZHD-ACCUITESSA-N |
| XLogP | 3.33 |
| TPSA | 128.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|