C29H33F3N2OS — CID 142351202
4-[(2Z,4Z)-2,6-difluorohexa-2,4-dien-3-yl]-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-2,3-dihydro-1-benzothiepin-8-amine (PubChem CID 142351202) has the molecular formula C29H33F3N2OS and a molecular weight of 514.66 g/mol. Its IUPAC name is 4-[(2Z,4Z)-2,6-difluorohexa-2,4-dien-3-yl]-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-2,3-dihydro-1-benzothiepin-8-amine.
| Compound Name | 4-[(2Z,4Z)-2,6-difluorohexa-2,4-dien-3-yl]-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-2,3-dihydro-1-benzothiepin-8-amine |
|---|---|
| PubChem CID | 142351202 |
| Molecular Formula | C29H33F3N2OS |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 4-[(2Z,4Z)-2,6-difluorohexa-2,4-dien-3-yl]-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-2,3-dihydro-1-benzothiepin-8-amine |
| SMILES | C/C(F)=C(\C=C/CF)C1=C(c2ccc(OC3CCN(CCCF)C3)cc2)c2ccc(N)cc2SCC1 |
| InChI | InChI=1S/C29H33F3N2OS/c1-20(32)25(4-2-13-30)26-12-17-36-28-18-22(33)7-10-27(28)29(26)21-5-8-23(9-6-21)35-24-11-16-34(19-24)15-3-14-31/h2,4-10,18,24H,3,11-17,19,33H2,1H3/b4-2-,25-20- |
| InChIKey | DEVXCPXLFJIJPG-PFFKXTDHSA-N |
| XLogP | 7.15 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|