C40H40BNO2 — CID 142353657
2-[(E)-(6-methylcyclohexa-2,4-dien-1-ylidene)-[2-[1-(4-phenylphenyl)ethenyl]phenyl]methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-azepine (PubChem CID 142353657) has the molecular formula C40H40BNO2 and a molecular weight of 577.58 g/mol. Its IUPAC name is 2-[(E)-(6-methylcyclohexa-2,4-dien-1-ylidene)-[2-[1-(4-phenylphenyl)ethenyl]phenyl]methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-azepine.
| Compound Name | 2-[(E)-(6-methylcyclohexa-2,4-dien-1-ylidene)-[2-[1-(4-phenylphenyl)ethenyl]phenyl]methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-azepine |
|---|---|
| PubChem CID | 142353657 |
| Molecular Formula | C40H40BNO2 |
| Molecular Weight | 577.58 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | 2-[(E)-(6-methylcyclohexa-2,4-dien-1-ylidene)-[2-[1-(4-phenylphenyl)ethenyl]phenyl]methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-azepine |
| SMILES | C=C(c1ccc(-c2ccccc2)cc1)c1ccccc1/C(C1=NC=C(B2OC(C)(C)C(C)(C)O2)C=CC1)=C1/C=CC=CC1C |
| InChI | InChI=1S/C40H40BNO2/c1-28-15-10-11-19-34(28)38(37-22-14-18-33(27-42-37)41-43-39(3,4)40(5,6)44-41)36-21-13-12-20-35(36)29(2)30-23-25-32(26-24-30)31-16-8-7-9-17-31/h7-21,23-28H,2,22H2,1,3-6H3/b38-34+ |
| InChIKey | SKLZCPFKMCMWCJ-XCWGLRIOSA-N |
| XLogP | 9.85 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.58 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|