C25H22N6O3 — CID 142361945
6-[(Z)-1-amino-3-iminoprop-1-enyl]-N-[4-[[3-(prop-2-enoylamino)benzoyl]amino]phenyl]pyridine-2-carboxamide (PubChem CID 142361945) has the molecular formula C25H22N6O3 and a molecular weight of 454.49 g/mol. Its IUPAC name is 6-[(Z)-1-amino-3-iminoprop-1-enyl]-N-[4-[[3-(prop-2-enoylamino)benzoyl]amino]phenyl]pyridine-2-carboxamide.
| Compound Name | 6-[(Z)-1-amino-3-iminoprop-1-enyl]-N-[4-[[3-(prop-2-enoylamino)benzoyl]amino]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142361945 |
| Molecular Formula | C25H22N6O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 6-[(Z)-1-amino-3-iminoprop-1-enyl]-N-[4-[[3-(prop-2-enoylamino)benzoyl]amino]phenyl]pyridine-2-carboxamide |
| SMILES | [H]/N=C/C=C(\N)c1cccc(C(=O)Nc2ccc(NC(=O)c3cccc(NC(=O)C=C)c3)cc2)n1 |
| InChI | InChI=1S/C25H22N6O3/c1-2-23(32)28-19-6-3-5-16(15-19)24(33)29-17-9-11-18(12-10-17)30-25(34)22-8-4-7-21(31-22)20(27)13-14-26/h2-15,26H,1,27H2,(H,28,32)(H,29,33)(H,30,34)/b20-13-,26-14+ |
| InChIKey | LRLNXYZBWFXKSR-VAYXRYNXSA-N |
| XLogP | 3.66 |
| TPSA | 150.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|