C28H31N5O3 — CID 177054918
N-[4-[[(3Z,5E,7Z)-7-amino-9-imino-6-methyl-2-methylidenenona-3,5,7-trienoyl]amino]phenyl]-3-(methylamino)benzamide;prop-2-enal (PubChem CID 177054918) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is N-[4-[[(3Z,5E,7Z)-7-amino-9-imino-6-methyl-2-methylidenenona-3,5,7-trienoyl]amino]phenyl]-3-(methylamino)benzamide;prop-2-enal.
| Compound Name | N-[4-[[(3Z,5E,7Z)-7-amino-9-imino-6-methyl-2-methylidenenona-3,5,7-trienoyl]amino]phenyl]-3-(methylamino)benzamide;prop-2-enal |
|---|---|
| PubChem CID | 177054918 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | N-[4-[[(3Z,5E,7Z)-7-amino-9-imino-6-methyl-2-methylidenenona-3,5,7-trienoyl]amino]phenyl]-3-(methylamino)benzamide;prop-2-enal |
| SMILES | C=CC=O.[H]/N=C/C=C(N)/C(C)=C/C=C\C(=C)C(=O)Nc1ccc(NC(=O)c2cccc(NC)c2)cc1 |
| InChI | InChI=1S/C25H27N5O2.C3H4O/c1-17(23(27)14-15-26)6-4-7-18(2)24(31)29-20-10-12-21(13-11-20)30-25(32)19-8-5-9-22(16-19)28-3;1-2-3-4/h4-16,26,28H,2,27H2,1,3H3,(H,29,31)(H,30,32);2-3H,1H2/b7-4-,17-6+,23-14-,26-15+; |
| InChIKey | XAHRNSKVXKEYMX-AEBDQWFNSA-N |
| XLogP | 4.84 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|