C20H24ClN3O3 — CID 142372576
ethyl 2-chloro-6-[5-(2-dispiro[2.0.24.13]heptan-7-ylethoxy)-1,5-dihydropyrazol-2-yl]pyridine-3-carboxylate (PubChem CID 142372576) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is ethyl 2-chloro-6-[5-(2-dispiro[2.0.24.13]heptan-7-ylethoxy)-1,5-dihydropyrazol-2-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 2-chloro-6-[5-(2-dispiro[2.0.24.13]heptan-7-ylethoxy)-1,5-dihydropyrazol-2-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 142372576 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | ethyl 2-chloro-6-[5-(2-dispiro[2.0.24.13]heptan-7-ylethoxy)-1,5-dihydropyrazol-2-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2C=CC(OCCC3C4(CC4)C34CC4)N2)nc1Cl |
| InChI | InChI=1S/C20H24ClN3O3/c1-2-26-18(25)13-3-4-15(22-17(13)21)24-11-5-16(23-24)27-12-6-14-19(7-8-19)20(14)9-10-20/h3-5,11,14,16,23H,2,6-10,12H2,1H3 |
| InChIKey | PIGLZUBJKNWALW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|