C25H49N — CID 142374781
(E)-7,7-diethyl-N,5-dimethyl-4-prop-1-en-2-ylundec-4-en-3-imine;pentane (PubChem CID 142374781) has the molecular formula C25H49N and a molecular weight of 363.67 g/mol. Its IUPAC name is (E)-7,7-diethyl-N,5-dimethyl-4-prop-1-en-2-ylundec-4-en-3-imine;pentane.
| Compound Name | (E)-7,7-diethyl-N,5-dimethyl-4-prop-1-en-2-ylundec-4-en-3-imine;pentane |
|---|---|
| PubChem CID | 142374781 |
| Molecular Formula | C25H49N |
| Molecular Weight | 363.67 g/mol |
| Exact Mass | 363.39 |
| IUPAC Name | (E)-7,7-diethyl-N,5-dimethyl-4-prop-1-en-2-ylundec-4-en-3-imine;pentane |
| SMILES | C=C(C)C(/C(CC)=N/C)=C(/C)CC(CC)(CC)CCCC.CCCCC |
| InChI | InChI=1S/C20H37N.C5H12/c1-9-13-14-20(11-3,12-4)15-17(7)19(16(5)6)18(10-2)21-8;1-3-5-4-2/h5,9-15H2,1-4,6-8H3;3-5H2,1-2H3/b19-17+,21-18+; |
| InChIKey | BFKLDEAHQDUPCR-ZHKSPIAZSA-N |
| XLogP | 8.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.67 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|