C42H70N2 — CID 89001590
3,6-bis[(E,4E)-4-(3,3-dimethylpentan-2-ylidene)dec-2-en-2-yl]-1-N,2-N-dimethylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 89001590) has the molecular formula C42H70N2 and a molecular weight of 603.04 g/mol. Its IUPAC name is 3,6-bis[(E,4E)-4-(3,3-dimethylpentan-2-ylidene)dec-2-en-2-yl]-1-N,2-N-dimethylcyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 3,6-bis[(E,4E)-4-(3,3-dimethylpentan-2-ylidene)dec-2-en-2-yl]-1-N,2-N-dimethylcyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 89001590 |
| Molecular Formula | C42H70N2 |
| Molecular Weight | 603.04 g/mol |
| Exact Mass | 602.55 |
| IUPAC Name | 3,6-bis[(E,4E)-4-(3,3-dimethylpentan-2-ylidene)dec-2-en-2-yl]-1-N,2-N-dimethylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | CCCCCCC(/C=C(\C)C1=CC=C(/C(C)=C/C(CCCCCC)=C(\C)C(C)(C)CC)C(=N/C)/C1=N\C)=C(/C)C(C)(C)CC |
| InChI | InChI=1S/C42H70N2/c1-15-19-21-23-25-35(33(7)41(9,10)17-3)29-31(5)37-27-28-38(40(44-14)39(37)43-13)32(6)30-36(26-24-22-20-16-2)34(8)42(11,12)18-4/h27-30H,15-26H2,1-14H3/b31-29+,32-30+,35-33+,36-34+,43-39-,44-40- |
| InChIKey | XLNJUWRWFDDNLJ-GTVSIOMMSA-N |
| XLogP | 13.33 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.04 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|