C18H19IO7S — CID 142377150
[2-[[2-(2-methylprop-2-enoylsulfanyl)acetyl]oxy-phenyl-λ3-iodanyl]oxy-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 142377150) has the molecular formula C18H19IO7S and a molecular weight of 506.31 g/mol. Its IUPAC name is [2-[[2-(2-methylprop-2-enoylsulfanyl)acetyl]oxy-phenyl-λ3-iodanyl]oxy-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[2-(2-methylprop-2-enoylsulfanyl)acetyl]oxy-phenyl-λ3-iodanyl]oxy-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142377150 |
| Molecular Formula | C18H19IO7S |
| Molecular Weight | 506.31 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | [2-[[2-(2-methylprop-2-enoylsulfanyl)acetyl]oxy-phenyl-λ3-iodanyl]oxy-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OI(OC(=O)CSC(=O)C(=C)C)c1ccccc1 |
| InChI | InChI=1S/C18H19IO7S/c1-12(2)17(22)24-10-15(20)25-19(14-8-6-5-7-9-14)26-16(21)11-27-18(23)13(3)4/h5-9H,1,3,10-11H2,2,4H3 |
| InChIKey | APMHHTLMSODXPY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|