C14H15IO5 — CID 142377177
[(4-hydroxyphenyl)-(2-methylprop-2-enoyloxy)-λ3-iodanyl] 2-methylprop-2-enoate (PubChem CID 142377177) has the molecular formula C14H15IO5 and a molecular weight of 390.17 g/mol. Its IUPAC name is [(4-hydroxyphenyl)-(2-methylprop-2-enoyloxy)-λ3-iodanyl] 2-methylprop-2-enoate.
| Compound Name | [(4-hydroxyphenyl)-(2-methylprop-2-enoyloxy)-λ3-iodanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142377177 |
| Molecular Formula | C14H15IO5 |
| Molecular Weight | 390.17 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | [(4-hydroxyphenyl)-(2-methylprop-2-enoyloxy)-λ3-iodanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OI(OC(=O)C(=C)C)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H15IO5/c1-9(2)13(17)19-15(20-14(18)10(3)4)11-5-7-12(16)8-6-11/h5-8,16H,1,3H2,2,4H3 |
| InChIKey | AZDOCHSQFFPLQV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.17 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|