C10H12N2 — CID 142387758
3-propan-2-yl-2H-pyrrolo[2,3-b]pyridine (PubChem CID 142387758) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-propan-2-yl-2H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-propan-2-yl-2H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 142387758 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-propan-2-yl-2H-pyrrolo[2,3-b]pyridine |
| SMILES | CC(C)C1=c2cccnc2=NC1 |
| InChI | InChI=1S/C10H12N2/c1-7(2)9-6-12-10-8(9)4-3-5-11-10/h3-5,7H,6H2,1-2H3 |
| InChIKey | WWLFXYGOOGYLHJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |