C19H35NO — CID 142389470
ethane;N-ethyl-N-[(3E)-2,5,6-trimethylhepta-1,3,5-trien-4-yl]oxan-4-amine (PubChem CID 142389470) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is ethane;N-ethyl-N-[(3E)-2,5,6-trimethylhepta-1,3,5-trien-4-yl]oxan-4-amine.
| Compound Name | ethane;N-ethyl-N-[(3E)-2,5,6-trimethylhepta-1,3,5-trien-4-yl]oxan-4-amine |
|---|---|
| PubChem CID | 142389470 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | ethane;N-ethyl-N-[(3E)-2,5,6-trimethylhepta-1,3,5-trien-4-yl]oxan-4-amine |
| SMILES | C=C(C)/C=C(\C(C)=C(C)C)N(CC)C1CCOCC1.CC |
| InChI | InChI=1S/C17H29NO.C2H6/c1-7-18(16-8-10-19-11-9-16)17(12-13(2)3)15(6)14(4)5;1-2/h12,16H,2,7-11H2,1,3-6H3;1-2H3/b17-12+; |
| InChIKey | DCDNUQATHDDOAE-KCUXUEJTSA-N |
| XLogP | 5.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|