C14H23NO — CID 144610641
N-ethyl-N-[(3E)-4-methylhexa-1,3,5-trien-3-yl]oxan-4-amine (PubChem CID 144610641) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N-ethyl-N-[(3E)-4-methylhexa-1,3,5-trien-3-yl]oxan-4-amine.
| Compound Name | N-ethyl-N-[(3E)-4-methylhexa-1,3,5-trien-3-yl]oxan-4-amine |
|---|---|
| PubChem CID | 144610641 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-ethyl-N-[(3E)-4-methylhexa-1,3,5-trien-3-yl]oxan-4-amine |
| SMILES | C=C/C(C)=C(\C=C)N(CC)C1CCOCC1 |
| InChI | InChI=1S/C14H23NO/c1-5-12(4)14(6-2)15(7-3)13-8-10-16-11-9-13/h5-6,13H,1-2,7-11H2,3-4H3/b14-12+ |
| InChIKey | UXIVVYOPYCDTRL-WYMLVPIESA-N |
| XLogP | 3.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|