C17H29NO — CID 142389471
N-ethyl-N-[(3E)-2,5,6-trimethylhepta-1,3,5-trien-4-yl]oxan-4-amine (PubChem CID 142389471) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is N-ethyl-N-[(3E)-2,5,6-trimethylhepta-1,3,5-trien-4-yl]oxan-4-amine.
| Compound Name | N-ethyl-N-[(3E)-2,5,6-trimethylhepta-1,3,5-trien-4-yl]oxan-4-amine |
|---|---|
| PubChem CID | 142389471 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | N-ethyl-N-[(3E)-2,5,6-trimethylhepta-1,3,5-trien-4-yl]oxan-4-amine |
| SMILES | C=C(C)/C=C(\C(C)=C(C)C)N(CC)C1CCOCC1 |
| InChI | InChI=1S/C17H29NO/c1-7-18(16-8-10-19-11-9-16)17(12-13(2)3)15(6)14(4)5/h12,16H,2,7-11H2,1,3-6H3/b17-12+ |
| InChIKey | SWEDXNPMPMXESV-SFQUDFHCSA-N |
| XLogP | 4.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|