About ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine
ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine (PubChem CID 142390477) has the molecular formula C18H35NO
and a molecular weight of 281.48 g/mol. Its IUPAC name is ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine |
| PubChem CID | 142390477 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine |
| SMILES | CC.CCCCCOc1ccc(CCNCCC)cc1.[H][H] |
| InChI | InChI=1S/C16H27NO.C2H6.H2/c1-3-5-6-14-18-16-9-7-15(8-10-16)11-13-17-12-4-2;1-2;/h7-10,17H,3-6,11-14H2,1-2H3;1-2H3;1H |
| InChIKey | ZBGOTWSVVDEKFT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine?
The IUPAC name of ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine (CID 142390477) is ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine.
What is the SMILES notation for ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine?
The canonical SMILES for ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine is CC.CCCCCOc1ccc(CCNCCC)cc1.[H][H].
What is the InChIKey of ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine?
The InChIKey is ZBGOTWSVVDEKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO.C2H6.H2/c1-3-5-6-14-18-16-9-7-15(8-10-16)11-13-17-12-4-2;1-2;/h7-10,17H,3-6,11-14H2,1-2H3;1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine?
ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine has a molecular weight of 281.48 g/mol, XLogP of 5.07, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;N-[2-(4-pentoxyphenyl)ethyl]propan-1-amine is sourced from PubChem (CID 142390477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).