C30H32ClNO2S — CID 142391944
3-chloro-2-methyl-1-benzothiophene;N-cyclohexyl-N-[[3-(3-methoxyphenyl)phenyl]methyl]formamide (PubChem CID 142391944) has the molecular formula C30H32ClNO2S and a molecular weight of 506.11 g/mol. Its IUPAC name is 3-chloro-2-methyl-1-benzothiophene;N-cyclohexyl-N-[[3-(3-methoxyphenyl)phenyl]methyl]formamide.
| Compound Name | 3-chloro-2-methyl-1-benzothiophene;N-cyclohexyl-N-[[3-(3-methoxyphenyl)phenyl]methyl]formamide |
|---|---|
| PubChem CID | 142391944 |
| Molecular Formula | C30H32ClNO2S |
| Molecular Weight | 506.11 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 3-chloro-2-methyl-1-benzothiophene;N-cyclohexyl-N-[[3-(3-methoxyphenyl)phenyl]methyl]formamide |
| SMILES | COc1cccc(-c2cccc(CN(C=O)C3CCCCC3)c2)c1.Cc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C21H25NO2.C9H7ClS/c1-24-21-12-6-9-19(14-21)18-8-5-7-17(13-18)15-22(16-23)20-10-3-2-4-11-20;1-6-9(10)7-4-2-3-5-8(7)11-6/h5-9,12-14,16,20H,2-4,10-11,15H2,1H3;2-5H,1H3 |
| InChIKey | ORBWLXYWJKSWOA-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.11 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|