C17H19N7O5S — CID 142400181
10-hydroxysulfanyloxy-7-N,7-N,5-trimethyl-9-oxo-3-N-pyridin-3-yl-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-3,7-dicarboxamide (PubChem CID 142400181) has the molecular formula C17H19N7O5S and a molecular weight of 433.45 g/mol. Its IUPAC name is 10-hydroxysulfanyloxy-7-N,7-N,5-trimethyl-9-oxo-3-N-pyridin-3-yl-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-3,7-dicarboxamide.
| Compound Name | 10-hydroxysulfanyloxy-7-N,7-N,5-trimethyl-9-oxo-3-N-pyridin-3-yl-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-3,7-dicarboxamide |
|---|---|
| PubChem CID | 142400181 |
| Molecular Formula | C17H19N7O5S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 10-hydroxysulfanyloxy-7-N,7-N,5-trimethyl-9-oxo-3-N-pyridin-3-yl-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-3,7-dicarboxamide |
| SMILES | CN(C)C(=O)C1c2c(c(C(=O)Nc3cccnc3)nn2C)C2CN1C(=O)N2OSO |
| InChI | InChI=1S/C17H19N7O5S/c1-21(2)16(26)14-13-11(10-8-23(14)17(27)24(10)29-30-28)12(20-22(13)3)15(25)19-9-5-4-6-18-7-9/h4-7,10,14,28H,8H2,1-3H3,(H,19,25) |
| InChIKey | VOFVXIBKWUXEJL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|