C16H31NO — CID 142406484
ethane;ethene;N-(2-methoxyethyl)-4-methyl-N-prop-1-en-2-ylpenta-1,3-dien-3-amine (PubChem CID 142406484) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is ethane;ethene;N-(2-methoxyethyl)-4-methyl-N-prop-1-en-2-ylpenta-1,3-dien-3-amine.
| Compound Name | ethane;ethene;N-(2-methoxyethyl)-4-methyl-N-prop-1-en-2-ylpenta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 142406484 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | ethane;ethene;N-(2-methoxyethyl)-4-methyl-N-prop-1-en-2-ylpenta-1,3-dien-3-amine |
| SMILES | C=C.C=CC(=C(C)C)N(CCOC)C(=C)C.CC |
| InChI | InChI=1S/C12H21NO.C2H6.C2H4/c1-7-12(10(2)3)13(11(4)5)8-9-14-6;2*1-2/h7H,1,4,8-9H2,2-3,5-6H3;1-2H3;1-2H2 |
| InChIKey | ROXRKPWUYWPLCI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|