C14H31NO3 — CID 142410133
N-butan-2-yl-2-methyl-2-(3-methylbutoxy)propanamide;methanol (PubChem CID 142410133) has the molecular formula C14H31NO3 and a molecular weight of 261.41 g/mol. Its IUPAC name is N-butan-2-yl-2-methyl-2-(3-methylbutoxy)propanamide;methanol.
| Compound Name | N-butan-2-yl-2-methyl-2-(3-methylbutoxy)propanamide;methanol |
|---|---|
| PubChem CID | 142410133 |
| Molecular Formula | C14H31NO3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.23 |
| IUPAC Name | N-butan-2-yl-2-methyl-2-(3-methylbutoxy)propanamide;methanol |
| SMILES | CCC(C)NC(=O)C(C)(C)OCCC(C)C.CO |
| InChI | InChI=1S/C13H27NO2.CH4O/c1-7-11(4)14-12(15)13(5,6)16-9-8-10(2)3;1-2/h10-11H,7-9H2,1-6H3,(H,14,15);2H,1H3 |
| InChIKey | FYJIWXWJUULMEL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |