C15H29N3 — CID 142416854
(E)-N'-methylbut-2-ene-1,4-diamine;(2Z)-N-methyl-2-propylidenecyclohexan-1-imine (PubChem CID 142416854) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is (E)-N'-methylbut-2-ene-1,4-diamine;(2Z)-N-methyl-2-propylidenecyclohexan-1-imine.
| Compound Name | (E)-N'-methylbut-2-ene-1,4-diamine;(2Z)-N-methyl-2-propylidenecyclohexan-1-imine |
|---|---|
| PubChem CID | 142416854 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | (E)-N'-methylbut-2-ene-1,4-diamine;(2Z)-N-methyl-2-propylidenecyclohexan-1-imine |
| SMILES | CC/C=C1/CCCC/C1=N\C.CNC/C=C/CN |
| InChI | InChI=1S/C10H17N.C5H12N2/c1-3-6-9-7-4-5-8-10(9)11-2;1-7-5-3-2-4-6/h6H,3-5,7-8H2,1-2H3;2-3,7H,4-6H2,1H3/b9-6-,11-10+;3-2+ |
| InChIKey | BRUAUBJIYPICFI-RTRWWWHSSA-N |
| XLogP | 2.69 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|