C8H15F — CID 142420761
3-fluoro-2,4-dimethylhex-2-ene (PubChem CID 142420761) has the molecular formula C8H15F and a molecular weight of 130.21 g/mol. Its IUPAC name is 3-fluoro-2,4-dimethylhex-2-ene.
| Compound Name | 3-fluoro-2,4-dimethylhex-2-ene |
|---|---|
| PubChem CID | 142420761 |
| Molecular Formula | C8H15F |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.12 |
| IUPAC Name | 3-fluoro-2,4-dimethylhex-2-ene |
| SMILES | CCC(C)C(F)=C(C)C |
| InChI | InChI=1S/C8H15F/c1-5-7(4)8(9)6(2)3/h7H,5H2,1-4H3 |
| InChIKey | YIEYWLGHYMJTDE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |