C23H33NO5 — CID 142420895
3-O-benzyl 2-O-tert-butyl (1R,3S,5R)-5-(5-hydroxypentyl)-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylate (PubChem CID 142420895) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is 3-O-benzyl 2-O-tert-butyl (1R,3S,5R)-5-(5-hydroxypentyl)-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylate.
| Compound Name | 3-O-benzyl 2-O-tert-butyl (1R,3S,5R)-5-(5-hydroxypentyl)-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142420895 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 3-O-benzyl 2-O-tert-butyl (1R,3S,5R)-5-(5-hydroxypentyl)-2-azabicyclo[3.1.0]hexane-2,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](C(=O)OCc2ccccc2)C[C@@]2(CCCCCO)C[C@@H]12 |
| InChI | InChI=1S/C23H33NO5/c1-22(2,3)29-21(27)24-18(20(26)28-16-17-10-6-4-7-11-17)14-23(15-19(23)24)12-8-5-9-13-25/h4,6-7,10-11,18-19,25H,5,8-9,12-16H2,1-3H3/t18-,19+,23-/m0/s1 |
| InChIKey | FAPDUYQROZSKEA-YYDVJCTNSA-N |
| XLogP | 4.05 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|