C20H22 — CID 142424728
9-ethyl-9-[(3E)-penta-1,3-dien-3-yl]-3,4-dihydrofluorene (PubChem CID 142424728) has the molecular formula C20H22 and a molecular weight of 262.40 g/mol. Its IUPAC name is 9-ethyl-9-[(3E)-penta-1,3-dien-3-yl]-3,4-dihydrofluorene.
| Compound Name | 9-ethyl-9-[(3E)-penta-1,3-dien-3-yl]-3,4-dihydrofluorene |
|---|---|
| PubChem CID | 142424728 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 9-ethyl-9-[(3E)-penta-1,3-dien-3-yl]-3,4-dihydrofluorene |
| SMILES | C=C/C(=C\C)C1(CC)C2=C(CCC=C2)c2ccccc21 |
| InChI | InChI=1S/C20H22/c1-4-15(5-2)20(6-3)18-13-9-7-11-16(18)17-12-8-10-14-19(17)20/h4-5,7,9-11,13-14H,1,6,8,12H2,2-3H3/b15-5+ |
| InChIKey | GYGRCVXYZSCGBP-PJQLUOCWSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|