C20H26O2S — CID 142428187
3-(but-3-enoxymethyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaene;ethane;methanethiol (PubChem CID 142428187) has the molecular formula C20H26O2S and a molecular weight of 330.49 g/mol. Its IUPAC name is 3-(but-3-enoxymethyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaene;ethane;methanethiol.
| Compound Name | 3-(but-3-enoxymethyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaene;ethane;methanethiol |
|---|---|
| PubChem CID | 142428187 |
| Molecular Formula | C20H26O2S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3-(but-3-enoxymethyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaene;ethane;methanethiol |
| SMILES | C=CCCOCC1=Cc2cccc3cccc(c23)O1.CC.CS |
| InChI | InChI=1S/C17H16O2.C2H6.CH4S/c1-2-3-10-18-12-15-11-14-8-4-6-13-7-5-9-16(19-15)17(13)14;2*1-2/h2,4-9,11H,1,3,10,12H2;1-2H3;2H,1H3 |
| InChIKey | GWHGMGBLYWPFKW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|