C8H3Br2Cl2N — CID 142429455
2,4-dichloro-6-(dibromomethyl)benzonitrile (PubChem CID 142429455) has the molecular formula C8H3Br2Cl2N and a molecular weight of 343.83 g/mol. Its IUPAC name is 2,4-dichloro-6-(dibromomethyl)benzonitrile.
| Compound Name | 2,4-dichloro-6-(dibromomethyl)benzonitrile |
|---|---|
| PubChem CID | 142429455 |
| Molecular Formula | C8H3Br2Cl2N |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 340.80 |
| IUPAC Name | 2,4-dichloro-6-(dibromomethyl)benzonitrile |
| SMILES | N#Cc1c(Cl)cc(Cl)cc1C(Br)Br |
| InChI | InChI=1S/C8H3Br2Cl2N/c9-8(10)5-1-4(11)2-7(12)6(5)3-13/h1-2,8H |
| InChIKey | WFHUNEPFWFJDOL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|