C13H8BrCl2N — CID 155108773
6-(1-bromoethyl)-2,4-dichloronaphthalene-1-carbonitrile (PubChem CID 155108773) has the molecular formula C13H8BrCl2N and a molecular weight of 329.02 g/mol. Its IUPAC name is 6-(1-bromoethyl)-2,4-dichloronaphthalene-1-carbonitrile.
| Compound Name | 6-(1-bromoethyl)-2,4-dichloronaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 155108773 |
| Molecular Formula | C13H8BrCl2N |
| Molecular Weight | 329.02 g/mol |
| Exact Mass | 326.92 |
| IUPAC Name | 6-(1-bromoethyl)-2,4-dichloronaphthalene-1-carbonitrile |
| SMILES | CC(Br)c1ccc2c(C#N)c(Cl)cc(Cl)c2c1 |
| InChI | InChI=1S/C13H8BrCl2N/c1-7(14)8-2-3-9-10(4-8)12(15)5-13(16)11(9)6-17/h2-5,7H,1H3 |
| InChIKey | MWNWNBRGRZIMNW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.02 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|