C15H8BrNO2 — CID 142429724
7-bromo-2-phenylquinoline-5,8-dione (PubChem CID 142429724) has the molecular formula C15H8BrNO2 and a molecular weight of 314.14 g/mol. Its IUPAC name is 7-bromo-2-phenylquinoline-5,8-dione.
| Compound Name | 7-bromo-2-phenylquinoline-5,8-dione |
|---|---|
| PubChem CID | 142429724 |
| Molecular Formula | C15H8BrNO2 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | 7-bromo-2-phenylquinoline-5,8-dione |
| SMILES | O=C1C=C(Br)C(=O)c2nc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C15H8BrNO2/c16-11-8-13(18)10-6-7-12(17-14(10)15(11)19)9-4-2-1-3-5-9/h1-8H |
| InChIKey | FKMZCJXIPKWRQE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|