C23H28FIN2O4S — CID 142431641
ethyl 7-[(2-fluoro-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]heptanoate (PubChem CID 142431641) has the molecular formula C23H28FIN2O4S and a molecular weight of 574.46 g/mol. Its IUPAC name is ethyl 7-[(2-fluoro-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]heptanoate.
| Compound Name | ethyl 7-[(2-fluoro-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]heptanoate |
|---|---|
| PubChem CID | 142431641 |
| Molecular Formula | C23H28FIN2O4S |
| Molecular Weight | 574.46 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | ethyl 7-[(2-fluoro-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCNC1c2ccccc2N(C)S(=O)(=O)c2cc(I)c(F)cc21 |
| InChI | InChI=1S/C23H28FIN2O4S/c1-3-31-22(28)12-6-4-5-9-13-26-23-16-10-7-8-11-20(16)27(2)32(29,30)21-15-19(25)18(24)14-17(21)23/h7-8,10-11,14-15,23,26H,3-6,9,12-13H2,1-2H3 |
| InChIKey | RXBWKYUGHYCZBU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|