C25H33IN2O5S — CID 142431699
N-(8-carboxyoctyl)-N-ethyl-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine oxide (PubChem CID 142431699) has the molecular formula C25H33IN2O5S and a molecular weight of 600.52 g/mol. Its IUPAC name is N-(8-carboxyoctyl)-N-ethyl-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine oxide.
| Compound Name | N-(8-carboxyoctyl)-N-ethyl-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine oxide |
|---|---|
| PubChem CID | 142431699 |
| Molecular Formula | C25H33IN2O5S |
| Molecular Weight | 600.52 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | N-(8-carboxyoctyl)-N-ethyl-3-iodo-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine oxide |
| SMILES | CC[N+]([O-])(CCCCCCCCC(=O)O)C1c2ccccc2N(C)S(=O)(=O)c2cc(I)ccc21 |
| InChI | InChI=1S/C25H33IN2O5S/c1-3-28(31,17-11-7-5-4-6-8-14-24(29)30)25-20-12-9-10-13-22(20)27(2)34(32,33)23-18-19(26)15-16-21(23)25/h9-10,12-13,15-16,18,25H,3-8,11,14,17H2,1-2H3,(H,29,30) |
| InChIKey | FSRZIFSVRAHCMS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|