C43H81NO7 — CID 142431907
4-O-[6-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]hexyl] 1-O-hexyl (E)-but-2-enedioate (PubChem CID 142431907) has the molecular formula C43H81NO7 and a molecular weight of 724.12 g/mol. Its IUPAC name is 4-O-[6-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]hexyl] 1-O-hexyl (E)-but-2-enedioate.
| Compound Name | 4-O-[6-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]hexyl] 1-O-hexyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 142431907 |
| Molecular Formula | C43H81NO7 |
| Molecular Weight | 724.12 g/mol |
| Exact Mass | 723.60 |
| IUPAC Name | 4-O-[6-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]hexyl] 1-O-hexyl (E)-but-2-enedioate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCO)CCCCCCOC(=O)/C=C/C(=O)OCCCCCC |
| InChI | InChI=1S/C43H81NO7/c1-4-7-10-13-16-22-29-40(30-23-17-14-11-8-5-2)51-43(48)31-24-18-15-19-25-34-44(36-37-45)35-26-20-21-28-39-50-42(47)33-32-41(46)49-38-27-12-9-6-3/h32-33,40,45H,4-31,34-39H2,1-3H3/b33-32+ |
| InChIKey | WOGIUNGCUZGFCK-ULIFNZDWSA-N |
| XLogP | 10.82 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.12 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|