C12H17N3O — CID 142433788
(3-amino-2,2-dimethyl-1,3-dihydroinden-5-yl)urea (PubChem CID 142433788) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is (3-amino-2,2-dimethyl-1,3-dihydroinden-5-yl)urea.
| Compound Name | (3-amino-2,2-dimethyl-1,3-dihydroinden-5-yl)urea |
|---|---|
| PubChem CID | 142433788 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (3-amino-2,2-dimethyl-1,3-dihydroinden-5-yl)urea |
| SMILES | CC1(C)Cc2ccc(NC(N)=O)cc2C1N |
| InChI | InChI=1S/C12H17N3O/c1-12(2)6-7-3-4-8(15-11(14)16)5-9(7)10(12)13/h3-5,10H,6,13H2,1-2H3,(H3,14,15,16) |
| InChIKey | CIAPHBQYRDSARQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |