C33H47ClN2O4S — CID 142444379
(7S)-22-(4-chloro-2-propylphenyl)-7-hydroxy-7-methyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-16(25),17,19(24)-trien-15-one;ethane (PubChem CID 142444379) has the molecular formula C33H47ClN2O4S and a molecular weight of 603.27 g/mol. Its IUPAC name is (7S)-22-(4-chloro-2-propylphenyl)-7-hydroxy-7-methyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-16(25),17,19(24)-trien-15-one;ethane.
| Compound Name | (7S)-22-(4-chloro-2-propylphenyl)-7-hydroxy-7-methyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-16(25),17,19(24)-trien-15-one;ethane |
|---|---|
| PubChem CID | 142444379 |
| Molecular Formula | C33H47ClN2O4S |
| Molecular Weight | 603.27 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | (7S)-22-(4-chloro-2-propylphenyl)-7-hydroxy-7-methyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-16(25),17,19(24)-trien-15-one;ethane |
| SMILES | CC.CCCc1cc(Cl)ccc1C1COc2ccc3cc2N(C1)CC1CCC1[C@@](C)(O)CCCCCS(=O)NC3=O |
| InChI | InChI=1S/C31H41ClN2O4S.C2H6/c1-3-7-21-16-25(32)10-11-26(21)24-19-34-18-23-8-12-27(23)31(2,36)14-5-4-6-15-39(37)33-30(35)22-9-13-29(38-20-24)28(34)17-22;1-2/h9-11,13,16-17,23-24,27,36H,3-8,12,14-15,18-20H2,1-2H3,(H,33,35);1-2H3/t23?,24?,27?,31-,39?;/m0./s1 |
| InChIKey | PNMZVTJCNOHLMH-VEVSLCDISA-N |
| XLogP | 7.05 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.27 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |