C31H41ClN2O4S — CID 145026131
(7Z)-20-(4-chloro-2-propylphenyl)-10,10-dimethyl-11-oxo-18-oxa-11λ4-thia-1,12-diazatetracyclo[12.7.2.03,6.017,22]tricosa-7,14(23),15,17(22)-tetraen-13-one;methanol (PubChem CID 145026131) has the molecular formula C31H41ClN2O4S and a molecular weight of 573.20 g/mol. Its IUPAC name is (7Z)-20-(4-chloro-2-propylphenyl)-10,10-dimethyl-11-oxo-18-oxa-11λ4-thia-1,12-diazatetracyclo[12.7.2.03,6.017,22]tricosa-7,14(23),15,17(22)-tetraen-13-one;methanol.
| Compound Name | (7Z)-20-(4-chloro-2-propylphenyl)-10,10-dimethyl-11-oxo-18-oxa-11λ4-thia-1,12-diazatetracyclo[12.7.2.03,6.017,22]tricosa-7,14(23),15,17(22)-tetraen-13-one;methanol |
|---|---|
| PubChem CID | 145026131 |
| Molecular Formula | C31H41ClN2O4S |
| Molecular Weight | 573.20 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | (7Z)-20-(4-chloro-2-propylphenyl)-10,10-dimethyl-11-oxo-18-oxa-11λ4-thia-1,12-diazatetracyclo[12.7.2.03,6.017,22]tricosa-7,14(23),15,17(22)-tetraen-13-one;methanol |
| SMILES | CCCc1cc(Cl)ccc1C1COc2ccc3cc2N(C1)CC1CCC1/C=C\CC(C)(C)S(=O)NC3=O.CO |
| InChI | InChI=1S/C30H37ClN2O3S.CH4O/c1-4-6-21-15-25(31)11-12-26(21)24-18-33-17-23-9-8-20(23)7-5-14-30(2,3)37(35)32-29(34)22-10-13-28(36-19-24)27(33)16-22;1-2/h5,7,10-13,15-16,20,23-24H,4,6,8-9,14,17-19H2,1-3H3,(H,32,34);2H,1H3/b7-5-; |
| InChIKey | FXHAJLYZLLLTLE-YJOCEBFMSA-N |
| XLogP | 6.04 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.20 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|