C34H43ClN2O4S — CID 155008454
22-(4-chloro-2-propylphenyl)-11-ethyl-7-methoxy-13-oxo-20-oxa-13λ4-thia-1,14-diazapentacyclo[14.7.2.18,10.03,6.019,24]hexacosa-8,16(25),17,19(24)-tetraen-15-one (PubChem CID 155008454) has the molecular formula C34H43ClN2O4S and a molecular weight of 611.25 g/mol. Its IUPAC name is 22-(4-chloro-2-propylphenyl)-11-ethyl-7-methoxy-13-oxo-20-oxa-13λ4-thia-1,14-diazapentacyclo[14.7.2.18,10.03,6.019,24]hexacosa-8,16(25),17,19(24)-tetraen-15-one.
| Compound Name | 22-(4-chloro-2-propylphenyl)-11-ethyl-7-methoxy-13-oxo-20-oxa-13λ4-thia-1,14-diazapentacyclo[14.7.2.18,10.03,6.019,24]hexacosa-8,16(25),17,19(24)-tetraen-15-one |
|---|---|
| PubChem CID | 155008454 |
| Molecular Formula | C34H43ClN2O4S |
| Molecular Weight | 611.25 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 22-(4-chloro-2-propylphenyl)-11-ethyl-7-methoxy-13-oxo-20-oxa-13λ4-thia-1,14-diazapentacyclo[14.7.2.18,10.03,6.019,24]hexacosa-8,16(25),17,19(24)-tetraen-15-one |
| SMILES | CCCc1cc(Cl)ccc1C1COc2ccc3cc2N(C1)CC1CCC1C(OC)C1=CC(C1)C(CC)CS(=O)NC3=O |
| InChI | InChI=1S/C34H43ClN2O4S/c1-4-6-22-15-28(35)9-11-29(22)27-18-37-17-24-7-10-30(24)33(40-3)26-13-25(14-26)21(5-2)20-42(39)36-34(38)23-8-12-32(41-19-27)31(37)16-23/h8-9,11-13,15-16,21,24-25,27,30,33H,4-7,10,14,17-20H2,1-3H3,(H,36,38) |
| InChIKey | YNRDUTIZYGXOES-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.25 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|