C19H16F5N3O2 — CID 142445144
1-amino-4-(3,4-difluorophenyl)-2-oxo-N-[2-(trifluoromethyl)phenyl]piperidine-3-carboxamide (PubChem CID 142445144) has the molecular formula C19H16F5N3O2 and a molecular weight of 413.35 g/mol. Its IUPAC name is 1-amino-4-(3,4-difluorophenyl)-2-oxo-N-[2-(trifluoromethyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-amino-4-(3,4-difluorophenyl)-2-oxo-N-[2-(trifluoromethyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 142445144 |
| Molecular Formula | C19H16F5N3O2 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 1-amino-4-(3,4-difluorophenyl)-2-oxo-N-[2-(trifluoromethyl)phenyl]piperidine-3-carboxamide |
| SMILES | NN1CCC(c2ccc(F)c(F)c2)C(C(=O)Nc2ccccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C19H16F5N3O2/c20-13-6-5-10(9-14(13)21)11-7-8-27(25)18(29)16(11)17(28)26-15-4-2-1-3-12(15)19(22,23)24/h1-6,9,11,16H,7-8,25H2,(H,26,28) |
| InChIKey | VJRZOROUTRWKMH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|