C20H37ClN5O5P — CID 142446145
[4-[[2-chloro-6-(cyclopentylamino)-5-methanimidoylpyrimidin-4-yl]amino]-4-methoxybutoxy]methylphosphonous acid;2-methylpropan-2-ol (PubChem CID 142446145) has the molecular formula C20H37ClN5O5P and a molecular weight of 493.97 g/mol. Its IUPAC name is [4-[[2-chloro-6-(cyclopentylamino)-5-methanimidoylpyrimidin-4-yl]amino]-4-methoxybutoxy]methylphosphonous acid;2-methylpropan-2-ol.
| Compound Name | [4-[[2-chloro-6-(cyclopentylamino)-5-methanimidoylpyrimidin-4-yl]amino]-4-methoxybutoxy]methylphosphonous acid;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 142446145 |
| Molecular Formula | C20H37ClN5O5P |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | [4-[[2-chloro-6-(cyclopentylamino)-5-methanimidoylpyrimidin-4-yl]amino]-4-methoxybutoxy]methylphosphonous acid;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.[H]/N=C/c1c(NC2CCCC2)nc(Cl)nc1NC(CCCOCP(O)O)OC |
| InChI | InChI=1S/C16H27ClN5O4P.C4H10O/c1-25-13(7-4-8-26-10-27(23)24)20-15-12(9-18)14(21-16(17)22-15)19-11-5-2-3-6-11;1-4(2,3)5/h9,11,13,18,23-24H,2-8,10H2,1H3,(H2,19,20,21,22);5H,1-3H3/b18-9+; |
| InChIKey | PBPBTZJTFNRDTL-WUBZALIBSA-N |
| XLogP | 3.69 |
| TPSA | 152.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|