C19H29NO2 — CID 14245140
5,5-diethoxy-2-(2-methylphenyl)-2-propan-2-ylpentanenitrile (PubChem CID 14245140) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 5,5-diethoxy-2-(2-methylphenyl)-2-propan-2-ylpentanenitrile.
| Compound Name | 5,5-diethoxy-2-(2-methylphenyl)-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 14245140 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 5,5-diethoxy-2-(2-methylphenyl)-2-propan-2-ylpentanenitrile |
| SMILES | CCOC(CCC(C#N)(c1ccccc1C)C(C)C)OCC |
| InChI | InChI=1S/C19H29NO2/c1-6-21-18(22-7-2)12-13-19(14-20,15(3)4)17-11-9-8-10-16(17)5/h8-11,15,18H,6-7,12-13H2,1-5H3 |
| InChIKey | XVMWRCOLMDTBSC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|