C28H27FN4O5 — CID 142456370
tert-butyl 3-[(Z)-3-(1,2-benzoxazol-3-yl)-4-(methylamino)-1,4-dioxobut-2-en-2-yl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate (PubChem CID 142456370) has the molecular formula C28H27FN4O5 and a molecular weight of 518.55 g/mol. Its IUPAC name is tert-butyl 3-[(Z)-3-(1,2-benzoxazol-3-yl)-4-(methylamino)-1,4-dioxobut-2-en-2-yl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate.
| Compound Name | tert-butyl 3-[(Z)-3-(1,2-benzoxazol-3-yl)-4-(methylamino)-1,4-dioxobut-2-en-2-yl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 142456370 |
| Molecular Formula | C28H27FN4O5 |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | tert-butyl 3-[(Z)-3-(1,2-benzoxazol-3-yl)-4-(methylamino)-1,4-dioxobut-2-en-2-yl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate |
| SMILES | CNC(=O)/C(=C(\C=O)c1cn2c3c(cc(F)cc13)CN(C(=O)OC(C)(C)C)CC2)c1noc2ccccc12 |
| InChI | InChI=1S/C28H27FN4O5/c1-28(2,3)37-27(36)33-10-9-32-14-20(19-12-17(29)11-16(13-33)25(19)32)21(15-34)23(26(35)30-4)24-18-7-5-6-8-22(18)38-31-24/h5-8,11-12,14-15H,9-10,13H2,1-4H3,(H,30,35)/b23-21+ |
| InChIKey | MZDKOVCPQKHEHY-XTQSDGFTSA-N |
| XLogP | 4.53 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|