C17H35NO2 — CID 142460709
3-[(2E,4E)-4-methoxyhexa-2,4-dien-3-yl]oxy-N,N-dimethylpropan-1-amine;pentane (PubChem CID 142460709) has the molecular formula C17H35NO2 and a molecular weight of 285.47 g/mol. Its IUPAC name is 3-[(2E,4E)-4-methoxyhexa-2,4-dien-3-yl]oxy-N,N-dimethylpropan-1-amine;pentane.
| Compound Name | 3-[(2E,4E)-4-methoxyhexa-2,4-dien-3-yl]oxy-N,N-dimethylpropan-1-amine;pentane |
|---|---|
| PubChem CID | 142460709 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | 3-[(2E,4E)-4-methoxyhexa-2,4-dien-3-yl]oxy-N,N-dimethylpropan-1-amine;pentane |
| SMILES | C/C=C(OC)\C(=C/C)OCCCN(C)C.CCCCC |
| InChI | InChI=1S/C12H23NO2.C5H12/c1-6-11(14-5)12(7-2)15-10-8-9-13(3)4;1-3-5-4-2/h6-7H,8-10H2,1-5H3;3-5H2,1-2H3/b11-6+,12-7+; |
| InChIKey | PEHBNPZWBHKTFE-BBLKRJOSSA-N |
| XLogP | 4.61 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|