C15H30N2O2 — CID 123589481
3-[3-[3-(dimethylamino)propoxy]penta-1,3-dien-2-yloxy]-N,N-dimethylpropan-1-amine (PubChem CID 123589481) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 3-[3-[3-(dimethylamino)propoxy]penta-1,3-dien-2-yloxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[3-[3-(dimethylamino)propoxy]penta-1,3-dien-2-yloxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 123589481 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 3-[3-[3-(dimethylamino)propoxy]penta-1,3-dien-2-yloxy]-N,N-dimethylpropan-1-amine |
| SMILES | C=C(OCCCN(C)C)C(=CC)OCCCN(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-7-15(19-13-9-11-17(5)6)14(2)18-12-8-10-16(3)4/h7H,2,8-13H2,1,3-6H3 |
| InChIKey | LKVPGJOKFDKDPV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|