C10H19NO — CID 143824322
N,N-dimethyl-3-[(3E)-penta-1,3-dien-3-yl]oxypropan-1-amine (PubChem CID 143824322) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is N,N-dimethyl-3-[(3E)-penta-1,3-dien-3-yl]oxypropan-1-amine.
| Compound Name | N,N-dimethyl-3-[(3E)-penta-1,3-dien-3-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 143824322 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | N,N-dimethyl-3-[(3E)-penta-1,3-dien-3-yl]oxypropan-1-amine |
| SMILES | C=C/C(=C\C)OCCCN(C)C |
| InChI | InChI=1S/C10H19NO/c1-5-10(6-2)12-9-7-8-11(3)4/h5-6H,1,7-9H2,2-4H3/b10-6+ |
| InChIKey | DXSVMYNLDYIXIH-UXBLZVDNSA-N |
| XLogP | 2.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|