C19H19N — CID 142461107
9-azatetracyclo[8.8.0.02,8.012,17]octadeca-1(18),2(8),3,6,10,12,14,16-octaene;ethane (PubChem CID 142461107) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 9-azatetracyclo[8.8.0.02,8.012,17]octadeca-1(18),2(8),3,6,10,12,14,16-octaene;ethane.
| Compound Name | 9-azatetracyclo[8.8.0.02,8.012,17]octadeca-1(18),2(8),3,6,10,12,14,16-octaene;ethane |
|---|---|
| PubChem CID | 142461107 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 9-azatetracyclo[8.8.0.02,8.012,17]octadeca-1(18),2(8),3,6,10,12,14,16-octaene;ethane |
| SMILES | C1=Cc2[nH]c3cc4ccccc4cc3c2C=CC1.CC |
| InChI | InChI=1S/C17H13N.C2H6/c1-2-8-14-15-10-12-6-4-5-7-13(12)11-17(15)18-16(14)9-3-1;1-2/h2-11,18H,1H2;1-2H3 |
| InChIKey | NMQWZLZKERUADP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |