C16H22N2 — CID 167507275
6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5,10,13-hexaene;ethane (PubChem CID 167507275) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5,10,13-hexaene;ethane.
| Compound Name | 6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5,10,13-hexaene;ethane |
|---|---|
| PubChem CID | 167507275 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5,10,13-hexaene;ethane |
| SMILES | C1=Cc2[nH]c3ncccc3c2C=CC1.CC.CC |
| InChI | InChI=1S/C12H10N2.2C2H6/c1-2-5-9-10-6-4-8-13-12(10)14-11(9)7-3-1;2*1-2/h2-8H,1H2,(H,13,14);2*1-2H3 |
| InChIKey | IPXUWLHQVWXZAY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |