C23H35NO5 — CID 142469305
[2-[2-(4,5-dihydroxy-2-methylphenyl)ethylamino]-2-oxoethyl] (2E)-3,7-dimethylocta-2,6-dienoate;ethane (PubChem CID 142469305) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is [2-[2-(4,5-dihydroxy-2-methylphenyl)ethylamino]-2-oxoethyl] (2E)-3,7-dimethylocta-2,6-dienoate;ethane.
| Compound Name | [2-[2-(4,5-dihydroxy-2-methylphenyl)ethylamino]-2-oxoethyl] (2E)-3,7-dimethylocta-2,6-dienoate;ethane |
|---|---|
| PubChem CID | 142469305 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | [2-[2-(4,5-dihydroxy-2-methylphenyl)ethylamino]-2-oxoethyl] (2E)-3,7-dimethylocta-2,6-dienoate;ethane |
| SMILES | CC.CC(C)=CCC/C(C)=C/C(=O)OCC(=O)NCCc1cc(O)c(O)cc1C |
| InChI | InChI=1S/C21H29NO5.C2H6/c1-14(2)6-5-7-15(3)10-21(26)27-13-20(25)22-9-8-17-12-19(24)18(23)11-16(17)4;1-2/h6,10-12,23-24H,5,7-9,13H2,1-4H3,(H,22,25);1-2H3/b15-10+; |
| InChIKey | CECQUEDICTYLSD-GYVLLFFHSA-N |
| XLogP | 4.33 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|