C37H57N5O10 — CID 142470468
diethyl 2-[[(3S)-5-[6-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]purin-9-yl]-3-(2-methoxypropan-2-yloxy)oxolan-2-yl]methoxy]propanedioate;ethane (PubChem CID 142470468) has the molecular formula C37H57N5O10 and a molecular weight of 731.89 g/mol. Its IUPAC name is diethyl 2-[[(3S)-5-[6-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]purin-9-yl]-3-(2-methoxypropan-2-yloxy)oxolan-2-yl]methoxy]propanedioate;ethane.
| Compound Name | diethyl 2-[[(3S)-5-[6-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]purin-9-yl]-3-(2-methoxypropan-2-yloxy)oxolan-2-yl]methoxy]propanedioate;ethane |
|---|---|
| PubChem CID | 142470468 |
| Molecular Formula | C37H57N5O10 |
| Molecular Weight | 731.89 g/mol |
| Exact Mass | 731.41 |
| IUPAC Name | diethyl 2-[[(3S)-5-[6-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]purin-9-yl]-3-(2-methoxypropan-2-yloxy)oxolan-2-yl]methoxy]propanedioate;ethane |
| SMILES | CC.CC.CCOC(=O)C(OCC1OC(n2cnc3c(N(Cc4ccccc4)C(=O)OC(C)(C)C)ncnc32)C[C@@H]1OC(C)(C)OC)C(=O)OCC |
| InChI | InChI=1S/C33H45N5O10.2C2H6/c1-9-43-29(39)26(30(40)44-10-2)45-18-23-22(47-33(6,7)42-8)16-24(46-23)38-20-36-25-27(34-19-35-28(25)38)37(31(41)48-32(3,4)5)17-21-14-12-11-13-15-21;2*1-2/h11-15,19-20,22-24,26H,9-10,16-18H2,1-8H3;2*1-2H3/t22-,23?,24?;;/m0../s1 |
| InChIKey | PBMSPCDFRYSFPE-XLGURKAOSA-N |
| XLogP | 6.39 |
| TPSA | 162.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.89 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|