C10H12Cl2N4O3 — CID 142470806
[3-[(2,6-dichloro-5-nitropyrimidin-4-yl)amino]cyclopentyl]methanol (PubChem CID 142470806) has the molecular formula C10H12Cl2N4O3 and a molecular weight of 307.14 g/mol. Its IUPAC name is [3-[(2,6-dichloro-5-nitropyrimidin-4-yl)amino]cyclopentyl]methanol.
| Compound Name | [3-[(2,6-dichloro-5-nitropyrimidin-4-yl)amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 142470806 |
| Molecular Formula | C10H12Cl2N4O3 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | [3-[(2,6-dichloro-5-nitropyrimidin-4-yl)amino]cyclopentyl]methanol |
| SMILES | O=[N+]([O-])c1c(Cl)nc(Cl)nc1NC1CCC(CO)C1 |
| InChI | InChI=1S/C10H12Cl2N4O3/c11-8-7(16(18)19)9(15-10(12)14-8)13-6-2-1-5(3-6)4-17/h5-6,17H,1-4H2,(H,13,14,15) |
| InChIKey | MRQNLJIAUCQOME-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|