C14H16Cl2N4O6 — CID 118475376
2-[[(3aR,4S,6R,6aS)-6-[(2,6-dichloro-5-nitropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetaldehyde (PubChem CID 118475376) has the molecular formula C14H16Cl2N4O6 and a molecular weight of 407.21 g/mol. Its IUPAC name is 2-[[(3aR,4S,6R,6aS)-6-[(2,6-dichloro-5-nitropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetaldehyde.
| Compound Name | 2-[[(3aR,4S,6R,6aS)-6-[(2,6-dichloro-5-nitropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetaldehyde |
|---|---|
| PubChem CID | 118475376 |
| Molecular Formula | C14H16Cl2N4O6 |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-[[(3aR,4S,6R,6aS)-6-[(2,6-dichloro-5-nitropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetaldehyde |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](OCC=O)C[C@H]2Nc1nc(Cl)nc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16Cl2N4O6/c1-14(2)25-9-6(5-7(10(9)26-14)24-4-3-21)17-12-8(20(22)23)11(15)18-13(16)19-12/h3,6-7,9-10H,4-5H2,1-2H3,(H,17,18,19)/t6-,7+,9+,10-/m1/s1 |
| InChIKey | NFSJALYRHVPQED-GOZTYBTRSA-N |
| XLogP | 1.98 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|