C16H34O2Si2 — CID 142478631
1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-trimethylsilylhex-5-yn-3-ol (PubChem CID 142478631) has the molecular formula C16H34O2Si2 and a molecular weight of 314.62 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-trimethylsilylhex-5-yn-3-ol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-trimethylsilylhex-5-yn-3-ol |
|---|---|
| PubChem CID | 142478631 |
| Molecular Formula | C16H34O2Si2 |
| Molecular Weight | 314.62 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-trimethylsilylhex-5-yn-3-ol |
| SMILES | CC(O)(CC#C[Si](C)(C)C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O2Si2/c1-15(2,3)20(8,9)18-13-12-16(4,17)11-10-14-19(5,6)7/h17H,11-13H2,1-9H3 |
| InChIKey | COFAYMROPLOQFF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|