C18H25N3O5 — CID 142478633
3-(3-hydroxy-3-methylbutyl)-5-nitro-1-(oxan-4-ylmethyl)benzimidazol-2-one (PubChem CID 142478633) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is 3-(3-hydroxy-3-methylbutyl)-5-nitro-1-(oxan-4-ylmethyl)benzimidazol-2-one.
| Compound Name | 3-(3-hydroxy-3-methylbutyl)-5-nitro-1-(oxan-4-ylmethyl)benzimidazol-2-one |
|---|---|
| PubChem CID | 142478633 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 3-(3-hydroxy-3-methylbutyl)-5-nitro-1-(oxan-4-ylmethyl)benzimidazol-2-one |
| SMILES | CC(C)(O)CCn1c(=O)n(CC2CCOCC2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H25N3O5/c1-18(2,23)7-8-19-16-11-14(21(24)25)3-4-15(16)20(17(19)22)12-13-5-9-26-10-6-13/h3-4,11,13,23H,5-10,12H2,1-2H3 |
| InChIKey | KHGKPOCSTCGKRF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|